C16H17NO2S — CID 58256814
4-[2-(cyclopentylmethyl)-1,3-thiazol-4-yl]benzoic acid (PubChem CID 58256814) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 4-[2-(cyclopentylmethyl)-1,3-thiazol-4-yl]benzoic acid.
| Compound Name | 4-[2-(cyclopentylmethyl)-1,3-thiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 58256814 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-[2-(cyclopentylmethyl)-1,3-thiazol-4-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2csc(CC3CCCC3)n2)cc1 |
| InChI | InChI=1S/C16H17NO2S/c18-16(19)13-7-5-12(6-8-13)14-10-20-15(17-14)9-11-3-1-2-4-11/h5-8,10-11H,1-4,9H2,(H,18,19) |
| InChIKey | WMIUBHIYEPSONG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |