C15H17NO2S2 — CID 65140990
4-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-4-yl]benzoic acid (PubChem CID 65140990) has the molecular formula C15H17NO2S2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 4-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-4-yl]benzoic acid.
| Compound Name | 4-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 65140990 |
| Molecular Formula | C15H17NO2S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-4-yl]benzoic acid |
| SMILES | CCC(C)SCc1nc(-c2ccc(C(=O)O)cc2)cs1 |
| InChI | InChI=1S/C15H17NO2S2/c1-3-10(2)19-9-14-16-13(8-20-14)11-4-6-12(7-5-11)15(17)18/h4-8,10H,3,9H2,1-2H3,(H,17,18) |
| InChIKey | JEUNMGLQFUSVCE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |