C15H17NO3S — CID 116732286
4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid (PubChem CID 116732286) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid.
| Compound Name | 4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 116732286 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid |
| SMILES | CCCC(OC)c1nc(-c2ccc(C(=O)O)cc2)cs1 |
| InChI | InChI=1S/C15H17NO3S/c1-3-4-13(19-2)14-16-12(9-20-14)10-5-7-11(8-6-10)15(17)18/h5-9,13H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | YOYFGFCZHBCOGY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |