4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid

C15H17NO3S — CID 116732286

IUPAC4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid
SMILESCCCC(OC)c1nc(-c2ccc(C(=O)O)cc2)cs1
InChIInChI=1S/C15H17NO3S/c1-3-4-13(19-2)14-16-12(9-20-14)10-5-7-11(8-6-10)15(17)18/h5-9,13H,3-4H2,1-2H3,(H,17,18)
InChIKeyYOYFGFCZHBCOGY-UHFFFAOYSA-N
MW291.37 g/mol
LogP4.00
Rot. Bonds6

About 4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid

4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid (PubChem CID 116732286) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid.

Molecular Properties

Compound Name4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid
PubChem CID116732286
Molecular FormulaC15H17NO3S
Molecular Weight291.37 g/mol
Exact Mass291.09
IUPAC Name4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid
SMILESCCCC(OC)c1nc(-c2ccc(C(=O)O)cc2)cs1
InChIInChI=1S/C15H17NO3S/c1-3-4-13(19-2)14-16-12(9-20-14)10-5-7-11(8-6-10)15(17)18/h5-9,13H,3-4H2,1-2H3,(H,17,18)
InChIKeyYOYFGFCZHBCOGY-UHFFFAOYSA-N
XLogP4.00
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.37
LogP ≤ 54.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid?
The IUPAC name of 4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid (CID 116732286) is 4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid.
What is the SMILES notation for 4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid?
The canonical SMILES for 4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid is CCCC(OC)c1nc(-c2ccc(C(=O)O)cc2)cs1.
What is the InChIKey of 4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid?
The InChIKey is YOYFGFCZHBCOGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3S/c1-3-4-13(19-2)14-16-12(9-20-14)10-5-7-11(8-6-10)15(17)18/h5-9,13H,3-4H2,1-2H3,(H,17,18).
What are the key properties of 4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid?
4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid has a molecular weight of 291.37 g/mol, XLogP of 4.00, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]benzoic acid is sourced from PubChem (CID 116732286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).