C16H19NO2S — CID 116727506
2-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]-1-phenylethanone (PubChem CID 116727506) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]-1-phenylethanone.
| Compound Name | 2-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 116727506 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-[2-(1-methoxybutyl)-1,3-thiazol-4-yl]-1-phenylethanone |
| SMILES | CCCC(OC)c1nc(CC(=O)c2ccccc2)cs1 |
| InChI | InChI=1S/C16H19NO2S/c1-3-7-15(19-2)16-17-13(11-20-16)10-14(18)12-8-5-4-6-9-12/h4-6,8-9,11,15H,3,7,10H2,1-2H3 |
| InChIKey | YHZSYEWYUUPJEF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |