C14H15NO3S2 — CID 116633076
2-[2-(1-methylsulfonylethyl)-1,3-thiazol-4-yl]-1-phenylethanone (PubChem CID 116633076) has the molecular formula C14H15NO3S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-[2-(1-methylsulfonylethyl)-1,3-thiazol-4-yl]-1-phenylethanone.
| Compound Name | 2-[2-(1-methylsulfonylethyl)-1,3-thiazol-4-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 116633076 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-[2-(1-methylsulfonylethyl)-1,3-thiazol-4-yl]-1-phenylethanone |
| SMILES | CC(c1nc(CC(=O)c2ccccc2)cs1)S(C)(=O)=O |
| InChI | InChI=1S/C14H15NO3S2/c1-10(20(2,17)18)14-15-12(9-19-14)8-13(16)11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | UEMBAJUXBLKOKN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |