C13H13NO2S2 — CID 4264597
2-[4-(4-ethylsulfanylphenyl)-1,3-thiazol-2-yl]acetic acid (PubChem CID 4264597) has the molecular formula C13H13NO2S2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 2-[4-(4-ethylsulfanylphenyl)-1,3-thiazol-2-yl]acetic acid.
| Compound Name | 2-[4-(4-ethylsulfanylphenyl)-1,3-thiazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 4264597 |
| Molecular Formula | C13H13NO2S2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 2-[4-(4-ethylsulfanylphenyl)-1,3-thiazol-2-yl]acetic acid |
| SMILES | CCSc1ccc(-c2csc(CC(=O)O)n2)cc1 |
| InChI | InChI=1S/C13H13NO2S2/c1-2-17-10-5-3-9(4-6-10)11-8-18-12(14-11)7-13(15)16/h3-6,8H,2,7H2,1H3,(H,15,16) |
| InChIKey | IEKLHYVFBDSESA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |