C11H12N2S2 — CID 3762953
4-(4-ethylsulfanylphenyl)-1,3-thiazol-2-amine (PubChem CID 3762953) has the molecular formula C11H12N2S2 and a molecular weight of 236.37 g/mol. Its IUPAC name is 4-(4-ethylsulfanylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-ethylsulfanylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3762953 |
| Molecular Formula | C11H12N2S2 |
| Molecular Weight | 236.37 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 4-(4-ethylsulfanylphenyl)-1,3-thiazol-2-amine |
| SMILES | CCSc1ccc(-c2csc(N)n2)cc1 |
| InChI | InChI=1S/C11H12N2S2/c1-2-14-9-5-3-8(4-6-9)10-7-15-11(12)13-10/h3-7H,2H2,1H3,(H2,12,13) |
| InChIKey | HPEKJCQERMXDNA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |