C11H13N3S2 — CID 116892116
[2-(4-ethylsulfanylphenyl)-1,3-thiazol-4-yl]hydrazine (PubChem CID 116892116) has the molecular formula C11H13N3S2 and a molecular weight of 251.38 g/mol. Its IUPAC name is [2-(4-ethylsulfanylphenyl)-1,3-thiazol-4-yl]hydrazine.
| Compound Name | [2-(4-ethylsulfanylphenyl)-1,3-thiazol-4-yl]hydrazine |
|---|---|
| PubChem CID | 116892116 |
| Molecular Formula | C11H13N3S2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | [2-(4-ethylsulfanylphenyl)-1,3-thiazol-4-yl]hydrazine |
| SMILES | CCSc1ccc(-c2nc(NN)cs2)cc1 |
| InChI | InChI=1S/C11H13N3S2/c1-2-15-9-5-3-8(4-6-9)11-13-10(14-12)7-16-11/h3-7,14H,2,12H2,1H3 |
| InChIKey | MKBVQQYWGGDGLQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|