C9H8ClN3S — CID 116892044
[2-(4-chlorophenyl)-1,3-thiazol-4-yl]hydrazine (PubChem CID 116892044) has the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-1,3-thiazol-4-yl]hydrazine.
| Compound Name | [2-(4-chlorophenyl)-1,3-thiazol-4-yl]hydrazine |
|---|---|
| PubChem CID | 116892044 |
| Molecular Formula | C9H8ClN3S |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | [2-(4-chlorophenyl)-1,3-thiazol-4-yl]hydrazine |
| SMILES | NNc1csc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C9H8ClN3S/c10-7-3-1-6(2-4-7)9-12-8(13-11)5-14-9/h1-5,13H,11H2 |
| InChIKey | QKOVXQFGFONDEL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|