C11H10N4OS — CID 116892127
[2-(2-methyl-1,3-benzoxazol-5-yl)-1,3-thiazol-4-yl]hydrazine (PubChem CID 116892127) has the molecular formula C11H10N4OS and a molecular weight of 246.30 g/mol. Its IUPAC name is [2-(2-methyl-1,3-benzoxazol-5-yl)-1,3-thiazol-4-yl]hydrazine.
| Compound Name | [2-(2-methyl-1,3-benzoxazol-5-yl)-1,3-thiazol-4-yl]hydrazine |
|---|---|
| PubChem CID | 116892127 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | [2-(2-methyl-1,3-benzoxazol-5-yl)-1,3-thiazol-4-yl]hydrazine |
| SMILES | Cc1nc2cc(-c3nc(NN)cs3)ccc2o1 |
| InChI | InChI=1S/C11H10N4OS/c1-6-13-8-4-7(2-3-9(8)16-6)11-14-10(15-12)5-17-11/h2-5,15H,12H2,1H3 |
| InChIKey | YGDZCBDRSRLGJB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|