C12H9N3O2S — CID 116892007
2-(2-methyl-1,3-benzoxazol-5-yl)-1,3-thiazole-4-carboxamide (PubChem CID 116892007) has the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-(2-methyl-1,3-benzoxazol-5-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2-methyl-1,3-benzoxazol-5-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 116892007 |
| Molecular Formula | C12H9N3O2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-(2-methyl-1,3-benzoxazol-5-yl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc2cc(-c3nc(C(N)=O)cs3)ccc2o1 |
| InChI | InChI=1S/C12H9N3O2S/c1-6-14-8-4-7(2-3-10(8)17-6)12-15-9(5-18-12)11(13)16/h2-5H,1H3,(H2,13,16) |
| InChIKey | NKMHPBAZTXYAQR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |