C12H9BrN2OS — CID 116970349
5-[2-(bromomethyl)-1,3-thiazol-4-yl]-2-methyl-1,3-benzoxazole (PubChem CID 116970349) has the molecular formula C12H9BrN2OS and a molecular weight of 309.19 g/mol. Its IUPAC name is 5-[2-(bromomethyl)-1,3-thiazol-4-yl]-2-methyl-1,3-benzoxazole.
| Compound Name | 5-[2-(bromomethyl)-1,3-thiazol-4-yl]-2-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 116970349 |
| Molecular Formula | C12H9BrN2OS |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | 5-[2-(bromomethyl)-1,3-thiazol-4-yl]-2-methyl-1,3-benzoxazole |
| SMILES | Cc1nc2cc(-c3csc(CBr)n3)ccc2o1 |
| InChI | InChI=1S/C12H9BrN2OS/c1-7-14-9-4-8(2-3-11(9)16-7)10-6-17-12(5-13)15-10/h2-4,6H,5H2,1H3 |
| InChIKey | BRSIHOZXWFGDER-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|