C12H11BrClNOS — CID 116970308
2-(bromomethyl)-4-(3-chloro-4-ethoxyphenyl)-1,3-thiazole (PubChem CID 116970308) has the molecular formula C12H11BrClNOS and a molecular weight of 332.65 g/mol. Its IUPAC name is 2-(bromomethyl)-4-(3-chloro-4-ethoxyphenyl)-1,3-thiazole.
| Compound Name | 2-(bromomethyl)-4-(3-chloro-4-ethoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116970308 |
| Molecular Formula | C12H11BrClNOS |
| Molecular Weight | 332.65 g/mol |
| Exact Mass | 330.94 |
| IUPAC Name | 2-(bromomethyl)-4-(3-chloro-4-ethoxyphenyl)-1,3-thiazole |
| SMILES | CCOc1ccc(-c2csc(CBr)n2)cc1Cl |
| InChI | InChI=1S/C12H11BrClNOS/c1-2-16-11-4-3-8(5-9(11)14)10-7-17-12(6-13)15-10/h3-5,7H,2,6H2,1H3 |
| InChIKey | XAYIGGVFROBYRZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.65 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|