C18H17ClN2OS — CID 20983705
[4-[4-(3-chloro-4-ethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methanamine (PubChem CID 20983705) has the molecular formula C18H17ClN2OS and a molecular weight of 344.87 g/mol. Its IUPAC name is [4-[4-(3-chloro-4-ethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methanamine.
| Compound Name | [4-[4-(3-chloro-4-ethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 20983705 |
| Molecular Formula | C18H17ClN2OS |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | [4-[4-(3-chloro-4-ethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methanamine |
| SMILES | CCOc1ccc(-c2csc(-c3ccc(CN)cc3)n2)cc1Cl |
| InChI | InChI=1S/C18H17ClN2OS/c1-2-22-17-8-7-14(9-15(17)19)16-11-23-18(21-16)13-5-3-12(10-20)4-6-13/h3-9,11H,2,10,20H2,1H3 |
| InChIKey | QAONGXPNXBSGIT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |