C11H8BrN3S — CID 116970345
4-(3H-benzimidazol-5-yl)-2-(bromomethyl)-1,3-thiazole (PubChem CID 116970345) has the molecular formula C11H8BrN3S and a molecular weight of 294.18 g/mol. Its IUPAC name is 4-(3H-benzimidazol-5-yl)-2-(bromomethyl)-1,3-thiazole.
| Compound Name | 4-(3H-benzimidazol-5-yl)-2-(bromomethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116970345 |
| Molecular Formula | C11H8BrN3S |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 292.96 |
| IUPAC Name | 4-(3H-benzimidazol-5-yl)-2-(bromomethyl)-1,3-thiazole |
| SMILES | BrCc1nc(-c2ccc3nc[nH]c3c2)cs1 |
| InChI | InChI=1S/C11H8BrN3S/c12-4-11-15-10(5-16-11)7-1-2-8-9(3-7)14-6-13-8/h1-3,5-6H,4H2,(H,13,14) |
| InChIKey | IWKUGIKHVCFZDQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|