C12H12N4OS — CID 116970222
[4-(2-methyl-1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]methylhydrazine (PubChem CID 116970222) has the molecular formula C12H12N4OS and a molecular weight of 260.32 g/mol. Its IUPAC name is [4-(2-methyl-1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]methylhydrazine.
| Compound Name | [4-(2-methyl-1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]methylhydrazine |
|---|---|
| PubChem CID | 116970222 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | [4-(2-methyl-1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]methylhydrazine |
| SMILES | Cc1nc2ccc(-c3csc(CNN)n3)cc2o1 |
| InChI | InChI=1S/C12H12N4OS/c1-7-15-9-3-2-8(4-11(9)17-7)10-6-18-12(16-10)5-14-13/h2-4,6,14H,5,13H2,1H3 |
| InChIKey | WHFFPNGFBYONGX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|