C12H8ClN3O — CID 116904381
6-(2-chloropyrimidin-4-yl)-2-methyl-1,3-benzoxazole (PubChem CID 116904381) has the molecular formula C12H8ClN3O and a molecular weight of 245.67 g/mol. Its IUPAC name is 6-(2-chloropyrimidin-4-yl)-2-methyl-1,3-benzoxazole.
| Compound Name | 6-(2-chloropyrimidin-4-yl)-2-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 116904381 |
| Molecular Formula | C12H8ClN3O |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 6-(2-chloropyrimidin-4-yl)-2-methyl-1,3-benzoxazole |
| SMILES | Cc1nc2ccc(-c3ccnc(Cl)n3)cc2o1 |
| InChI | InChI=1S/C12H8ClN3O/c1-7-15-10-3-2-8(6-11(10)17-7)9-4-5-14-12(13)16-9/h2-6H,1H3 |
| InChIKey | CUYCUYLRAGMIDJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |