About 6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole
6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole (PubChem CID 116854709) has the molecular formula C14H9BrN4O
and a molecular weight of 329.16 g/mol. Its IUPAC name is 6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole |
| PubChem CID | 116854709 |
| Molecular Formula | C14H9BrN4O |
| Molecular Weight | 329.16 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole |
| SMILES | Cc1nc2ccc(-c3ccc4ncc(Br)n4n3)cc2o1 |
| InChI | InChI=1S/C14H9BrN4O/c1-8-17-11-3-2-9(6-12(11)20-8)10-4-5-14-16-7-13(15)19(14)18-10/h2-7H,1H3 |
| InChIKey | YYWHTHVCJBUOLH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.16 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole?
The IUPAC name of 6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole (CID 116854709) is 6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole.
What is the SMILES notation for 6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole?
The canonical SMILES for 6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole is Cc1nc2ccc(-c3ccc4ncc(Br)n4n3)cc2o1.
What is the InChIKey of 6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole?
The InChIKey is YYWHTHVCJBUOLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9BrN4O/c1-8-17-11-3-2-9(6-12(11)20-8)10-4-5-14-16-7-13(15)19(14)18-10/h2-7H,1H3.
What are the key properties of 6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole?
6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole has a molecular weight of 329.16 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-bromoimidazo[1,2-b]pyridazin-6-yl)-2-methyl-1,3-benzoxazole is sourced from PubChem (CID 116854709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).