C8H6INO — CID 119084609
6-iodo-2-methyl-1,3-benzoxazole (PubChem CID 119084609) has the molecular formula C8H6INO and a molecular weight of 259.05 g/mol. Its IUPAC name is 6-iodo-2-methyl-1,3-benzoxazole.
| Compound Name | 6-iodo-2-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 119084609 |
| Molecular Formula | C8H6INO |
| Molecular Weight | 259.05 g/mol |
| Exact Mass | 258.95 |
| IUPAC Name | 6-iodo-2-methyl-1,3-benzoxazole |
| SMILES | Cc1nc2ccc(I)cc2o1 |
| InChI | InChI=1S/C8H6INO/c1-5-10-7-3-2-6(9)4-8(7)11-5/h2-4H,1H3 |
| InChIKey | NOLHZWFWZDDNTC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.05 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|