C13H7BrINO — CID 172702567
2-(4-bromophenyl)-6-iodo-1,3-benzoxazole (PubChem CID 172702567) has the molecular formula C13H7BrINO and a molecular weight of 400.01 g/mol. Its IUPAC name is 2-(4-bromophenyl)-6-iodo-1,3-benzoxazole.
| Compound Name | 2-(4-bromophenyl)-6-iodo-1,3-benzoxazole |
|---|---|
| PubChem CID | 172702567 |
| Molecular Formula | C13H7BrINO |
| Molecular Weight | 400.01 g/mol |
| Exact Mass | 398.88 |
| IUPAC Name | 2-(4-bromophenyl)-6-iodo-1,3-benzoxazole |
| SMILES | Brc1ccc(-c2nc3ccc(I)cc3o2)cc1 |
| InChI | InChI=1S/C13H7BrINO/c14-9-3-1-8(2-4-9)13-16-11-6-5-10(15)7-12(11)17-13/h1-7H |
| InChIKey | DDUKGXIHOJIBPD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.01 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|