C15H9BrINO2 — CID 67140754
1-[5-bromo-2-(4-iodophenyl)-1,3-benzoxazol-7-yl]ethanone (PubChem CID 67140754) has the molecular formula C15H9BrINO2 and a molecular weight of 442.05 g/mol. Its IUPAC name is 1-[5-bromo-2-(4-iodophenyl)-1,3-benzoxazol-7-yl]ethanone.
| Compound Name | 1-[5-bromo-2-(4-iodophenyl)-1,3-benzoxazol-7-yl]ethanone |
|---|---|
| PubChem CID | 67140754 |
| Molecular Formula | C15H9BrINO2 |
| Molecular Weight | 442.05 g/mol |
| Exact Mass | 440.89 |
| IUPAC Name | 1-[5-bromo-2-(4-iodophenyl)-1,3-benzoxazol-7-yl]ethanone |
| SMILES | CC(=O)c1cc(Br)cc2nc(-c3ccc(I)cc3)oc12 |
| InChI | InChI=1S/C15H9BrINO2/c1-8(19)12-6-10(16)7-13-14(12)20-15(18-13)9-2-4-11(17)5-3-9/h2-7H,1H3 |
| InChIKey | QZVUVIQCCSQLIS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.05 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|