C17H9IN2O5 — CID 95911710
prop-2-ynyl 2-(4-iodophenyl)-5-nitro-1,3-benzoxazole-7-carboxylate (PubChem CID 95911710) has the molecular formula C17H9IN2O5 and a molecular weight of 448.17 g/mol. Its IUPAC name is prop-2-ynyl 2-(4-iodophenyl)-5-nitro-1,3-benzoxazole-7-carboxylate.
| Compound Name | prop-2-ynyl 2-(4-iodophenyl)-5-nitro-1,3-benzoxazole-7-carboxylate |
|---|---|
| PubChem CID | 95911710 |
| Molecular Formula | C17H9IN2O5 |
| Molecular Weight | 448.17 g/mol |
| Exact Mass | 447.96 |
| IUPAC Name | prop-2-ynyl 2-(4-iodophenyl)-5-nitro-1,3-benzoxazole-7-carboxylate |
| SMILES | C#CCOC(=O)c1cc([N+](=O)[O-])cc2nc(-c3ccc(I)cc3)oc12 |
| InChI | InChI=1S/C17H9IN2O5/c1-2-7-24-17(21)13-8-12(20(22)23)9-14-15(13)25-16(19-14)10-3-5-11(18)6-4-10/h1,3-6,8-9H,7H2 |
| InChIKey | ZHHDTDDJTBAVJR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.17 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|