C15H10FN3O5 — CID 156640353
ethyl 4-(7-fluoro-5-nitro-1,3-benzoxazol-2-yl)pyridine-2-carboxylate (PubChem CID 156640353) has the molecular formula C15H10FN3O5 and a molecular weight of 331.26 g/mol. Its IUPAC name is ethyl 4-(7-fluoro-5-nitro-1,3-benzoxazol-2-yl)pyridine-2-carboxylate.
| Compound Name | ethyl 4-(7-fluoro-5-nitro-1,3-benzoxazol-2-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 156640353 |
| Molecular Formula | C15H10FN3O5 |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | ethyl 4-(7-fluoro-5-nitro-1,3-benzoxazol-2-yl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2nc3cc([N+](=O)[O-])cc(F)c3o2)ccn1 |
| InChI | InChI=1S/C15H10FN3O5/c1-2-23-15(20)12-5-8(3-4-17-12)14-18-11-7-9(19(21)22)6-10(16)13(11)24-14/h3-7H,2H2,1H3 |
| InChIKey | HEUDFNNTWHVJTO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|