C22H22N2O5 — CID 70164860
ethyl 2-(4-tert-butylphenyl)-5-(3-nitrophenyl)-1,3-oxazole-4-carboxylate (PubChem CID 70164860) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is ethyl 2-(4-tert-butylphenyl)-5-(3-nitrophenyl)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-(4-tert-butylphenyl)-5-(3-nitrophenyl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 70164860 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | ethyl 2-(4-tert-butylphenyl)-5-(3-nitrophenyl)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc(C(C)(C)C)cc2)oc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H22N2O5/c1-5-28-21(25)18-19(15-7-6-8-17(13-15)24(26)27)29-20(23-18)14-9-11-16(12-10-14)22(2,3)4/h6-13H,5H2,1-4H3 |
| InChIKey | VXFCODNOKBGYDE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|