C11H8N2O5 — CID 62232635
5-methyl-2-(3-nitrophenyl)-1,3-oxazole-4-carboxylic acid (PubChem CID 62232635) has the molecular formula C11H8N2O5 and a molecular weight of 248.19 g/mol. Its IUPAC name is 5-methyl-2-(3-nitrophenyl)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 5-methyl-2-(3-nitrophenyl)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 62232635 |
| Molecular Formula | C11H8N2O5 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 5-methyl-2-(3-nitrophenyl)-1,3-oxazole-4-carboxylic acid |
| SMILES | Cc1oc(-c2cccc([N+](=O)[O-])c2)nc1C(=O)O |
| InChI | InChI=1S/C11H8N2O5/c1-6-9(11(14)15)12-10(18-6)7-3-2-4-8(5-7)13(16)17/h2-5H,1H3,(H,14,15) |
| InChIKey | IIWXMNPPFWNWSK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|