C9H6N2O6 — CID 62235043
5-methyl-2-(5-nitrofuran-2-yl)-1,3-oxazole-4-carboxylic acid (PubChem CID 62235043) has the molecular formula C9H6N2O6 and a molecular weight of 238.16 g/mol. Its IUPAC name is 5-methyl-2-(5-nitrofuran-2-yl)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 5-methyl-2-(5-nitrofuran-2-yl)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 62235043 |
| Molecular Formula | C9H6N2O6 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 5-methyl-2-(5-nitrofuran-2-yl)-1,3-oxazole-4-carboxylic acid |
| SMILES | Cc1oc(-c2ccc([N+](=O)[O-])o2)nc1C(=O)O |
| InChI | InChI=1S/C9H6N2O6/c1-4-7(9(12)13)10-8(16-4)5-2-3-6(17-5)11(14)15/h2-3H,1H3,(H,12,13) |
| InChIKey | IJAJOTIBLXKMOB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|