C8H5N3O6 — CID 154119758
5-amino-3-(5-nitrofuran-2-yl)-1,2-oxazole-4-carboxylic acid (PubChem CID 154119758) has the molecular formula C8H5N3O6 and a molecular weight of 239.14 g/mol. Its IUPAC name is 5-amino-3-(5-nitrofuran-2-yl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 5-amino-3-(5-nitrofuran-2-yl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 154119758 |
| Molecular Formula | C8H5N3O6 |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 5-amino-3-(5-nitrofuran-2-yl)-1,2-oxazole-4-carboxylic acid |
| SMILES | Nc1onc(-c2ccc([N+](=O)[O-])o2)c1C(=O)O |
| InChI | InChI=1S/C8H5N3O6/c9-7-5(8(12)13)6(10-17-7)3-1-2-4(16-3)11(14)15/h1-2H,9H2,(H,12,13) |
| InChIKey | LZAFEDLZPLMFLW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 145.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|