C8H6N4O4S — CID 56615074
4-(5-nitrofuran-2-yl)-1,3-thiazole-2-carbohydrazide (PubChem CID 56615074) has the molecular formula C8H6N4O4S and a molecular weight of 254.23 g/mol. Its IUPAC name is 4-(5-nitrofuran-2-yl)-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-(5-nitrofuran-2-yl)-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 56615074 |
| Molecular Formula | C8H6N4O4S |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 4-(5-nitrofuran-2-yl)-1,3-thiazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(-c2ccc([N+](=O)[O-])o2)cs1 |
| InChI | InChI=1S/C8H6N4O4S/c9-11-7(13)8-10-4(3-17-8)5-1-2-6(16-5)12(14)15/h1-3H,9H2,(H,11,13) |
| InChIKey | KODZKHBDTPPXIQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|