C16H8ClN3O3S — CID 3749661
2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(5-nitrofuran-2-yl)prop-2-enenitrile (PubChem CID 3749661) has the molecular formula C16H8ClN3O3S and a molecular weight of 357.78 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(5-nitrofuran-2-yl)prop-2-enenitrile.
| Compound Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(5-nitrofuran-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3749661 |
| Molecular Formula | C16H8ClN3O3S |
| Molecular Weight | 357.78 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(5-nitrofuran-2-yl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc([N+](=O)[O-])o1)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C16H8ClN3O3S/c17-12-3-1-10(2-4-12)14-9-24-16(19-14)11(8-18)7-13-5-6-15(23-13)20(21)22/h1-7,9H |
| InChIKey | GLRJEJBMFDVILE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 92.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.78 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|