C7H4IN3O3S — CID 12007693
5-iodo-4-(5-nitrofuran-2-yl)-1,3-thiazol-2-amine (PubChem CID 12007693) has the molecular formula C7H4IN3O3S and a molecular weight of 337.10 g/mol. Its IUPAC name is 5-iodo-4-(5-nitrofuran-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 5-iodo-4-(5-nitrofuran-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 12007693 |
| Molecular Formula | C7H4IN3O3S |
| Molecular Weight | 337.10 g/mol |
| Exact Mass | 336.90 |
| IUPAC Name | 5-iodo-4-(5-nitrofuran-2-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccc([N+](=O)[O-])o2)c(I)s1 |
| InChI | InChI=1S/C7H4IN3O3S/c8-6-5(10-7(9)15-6)3-1-2-4(14-3)11(12)13/h1-2H,(H2,9,10) |
| InChIKey | RTOJOLDWBXNCSF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.10 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|