C8H7N3O3S2 — CID 13327587
2-methylsulfanyl-5-(5-nitrofuran-2-yl)-1,3-thiazol-4-amine (PubChem CID 13327587) has the molecular formula C8H7N3O3S2 and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-methylsulfanyl-5-(5-nitrofuran-2-yl)-1,3-thiazol-4-amine.
| Compound Name | 2-methylsulfanyl-5-(5-nitrofuran-2-yl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 13327587 |
| Molecular Formula | C8H7N3O3S2 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 2-methylsulfanyl-5-(5-nitrofuran-2-yl)-1,3-thiazol-4-amine |
| SMILES | CSc1nc(N)c(-c2ccc([N+](=O)[O-])o2)s1 |
| InChI | InChI=1S/C8H7N3O3S2/c1-15-8-10-7(9)6(16-8)4-2-3-5(14-4)11(12)13/h2-3H,9H2,1H3 |
| InChIKey | YZZAORHTANOSQN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|