C11H4ClN5O3 — CID 641460
2-amino-6-chloro-4-(5-nitrofuran-2-yl)pyridine-3,5-dicarbonitrile (PubChem CID 641460) has the molecular formula C11H4ClN5O3 and a molecular weight of 289.64 g/mol. Its IUPAC name is 2-amino-6-chloro-4-(5-nitrofuran-2-yl)pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-chloro-4-(5-nitrofuran-2-yl)pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 641460 |
| Molecular Formula | C11H4ClN5O3 |
| Molecular Weight | 289.64 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 2-amino-6-chloro-4-(5-nitrofuran-2-yl)pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)nc(Cl)c(C#N)c1-c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C11H4ClN5O3/c12-10-5(3-13)9(6(4-14)11(15)16-10)7-1-2-8(20-7)17(18)19/h1-2H,(H2,15,16) |
| InChIKey | PMVXSIXXNUYBON-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 142.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.64 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|