C24H15N5O3S — CID 2833656
2-amino-6-benzylsulfanyl-4-[5-(2-nitrophenyl)furan-2-yl]pyridine-3,5-dicarbonitrile (PubChem CID 2833656) has the molecular formula C24H15N5O3S and a molecular weight of 453.48 g/mol. Its IUPAC name is 2-amino-6-benzylsulfanyl-4-[5-(2-nitrophenyl)furan-2-yl]pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-benzylsulfanyl-4-[5-(2-nitrophenyl)furan-2-yl]pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 2833656 |
| Molecular Formula | C24H15N5O3S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 2-amino-6-benzylsulfanyl-4-[5-(2-nitrophenyl)furan-2-yl]pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)nc(SCc2ccccc2)c(C#N)c1-c1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C24H15N5O3S/c25-12-17-22(21-11-10-20(32-21)16-8-4-5-9-19(16)29(30)31)18(13-26)24(28-23(17)27)33-14-15-6-2-1-3-7-15/h1-11H,14H2,(H2,27,28) |
| InChIKey | BVSJBLYEIRHIIY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 142.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|