C25H20N6O3S — CID 58739664
2-amino-4-(2-nitrophenyl)-6-(2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl)sulfanylpyridine-3,5-dicarbonitrile (PubChem CID 58739664) has the molecular formula C25H20N6O3S and a molecular weight of 484.54 g/mol. Its IUPAC name is 2-amino-4-(2-nitrophenyl)-6-(2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl)sulfanylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(2-nitrophenyl)-6-(2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl)sulfanylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 58739664 |
| Molecular Formula | C25H20N6O3S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 2-amino-4-(2-nitrophenyl)-6-(2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl)sulfanylpyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)nc(SC(C(=O)N2CCCC2)c2ccccc2)c(C#N)c1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H20N6O3S/c26-14-18-21(17-10-4-5-11-20(17)31(33)34)19(15-27)24(29-23(18)28)35-22(16-8-2-1-3-9-16)25(32)30-12-6-7-13-30/h1-5,8-11,22H,6-7,12-13H2,(H2,28,29) |
| InChIKey | RUOBGZNLMYYWFI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 149.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|