C12H10LiN3O6S — CID 155823011
lithium 4-[[4-methyl-5-(5-nitrofuran-2-yl)-1,3-thiazol-2-yl]amino]-4-oxobutanoate (PubChem CID 155823011) has the molecular formula C12H10LiN3O6S and a molecular weight of 331.24 g/mol. Its IUPAC name is lithium 4-[[4-methyl-5-(5-nitrofuran-2-yl)-1,3-thiazol-2-yl]amino]-4-oxobutanoate.
| Compound Name | lithium 4-[[4-methyl-5-(5-nitrofuran-2-yl)-1,3-thiazol-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 155823011 |
| Molecular Formula | C12H10LiN3O6S |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | lithium 4-[[4-methyl-5-(5-nitrofuran-2-yl)-1,3-thiazol-2-yl]amino]-4-oxobutanoate |
| SMILES | Cc1nc(NC(=O)CCC(=O)[O-])sc1-c1ccc([N+](=O)[O-])o1.[Li+] |
| InChI | InChI=1S/C12H11N3O6S.Li/c1-6-11(7-2-4-9(21-7)15(19)20)22-12(13-6)14-8(16)3-5-10(17)18;/h2,4H,3,5H2,1H3,(H,17,18)(H,13,14,16);/q;+1/p-1 |
| InChIKey | AOCANRTWUJKZFI-UHFFFAOYSA-M |
| XLogP | -1.91 |
| TPSA | 138.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|