C18H16N4O3S — CID 18322909
1-benzyl-3-[4-methyl-5-(3-nitrophenyl)-1,3-thiazol-2-yl]urea (PubChem CID 18322909) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is 1-benzyl-3-[4-methyl-5-(3-nitrophenyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-benzyl-3-[4-methyl-5-(3-nitrophenyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 18322909 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 1-benzyl-3-[4-methyl-5-(3-nitrophenyl)-1,3-thiazol-2-yl]urea |
| SMILES | Cc1nc(NC(=O)NCc2ccccc2)sc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N4O3S/c1-12-16(14-8-5-9-15(10-14)22(24)25)26-18(20-12)21-17(23)19-11-13-6-3-2-4-7-13/h2-10H,11H2,1H3,(H2,19,20,21,23) |
| InChIKey | BHTAREQOWMDQCL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|