C19H13N5O4S — CID 39040887
N-[4-methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-yl]-3-nitrobenzamide (PubChem CID 39040887) has the molecular formula C19H13N5O4S and a molecular weight of 407.41 g/mol. Its IUPAC name is N-[4-methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-yl]-3-nitrobenzamide.
| Compound Name | N-[4-methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 39040887 |
| Molecular Formula | C19H13N5O4S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-[4-methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
| SMILES | Cc1nc(NC(=O)c2cccc([N+](=O)[O-])c2)sc1-c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C19H13N5O4S/c1-11-15(18-21-16(23-28-18)12-6-3-2-4-7-12)29-19(20-11)22-17(25)13-8-5-9-14(10-13)24(26)27/h2-10H,1H3,(H,20,22,25) |
| InChIKey | GXLZMSGHRYLMRO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|