C20H14FN5O5S — CID 39043081
N-[5-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-4-methyl-1,3-thiazol-2-yl]-2-(2-nitrophenoxy)acetamide (PubChem CID 39043081) has the molecular formula C20H14FN5O5S and a molecular weight of 455.43 g/mol. Its IUPAC name is N-[5-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-4-methyl-1,3-thiazol-2-yl]-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-[5-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-4-methyl-1,3-thiazol-2-yl]-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 39043081 |
| Molecular Formula | C20H14FN5O5S |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N-[5-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-4-methyl-1,3-thiazol-2-yl]-2-(2-nitrophenoxy)acetamide |
| SMILES | Cc1nc(NC(=O)COc2ccccc2[N+](=O)[O-])sc1-c1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C20H14FN5O5S/c1-11-17(19-24-18(25-31-19)12-6-8-13(21)9-7-12)32-20(22-11)23-16(27)10-30-15-5-3-2-4-14(15)26(28)29/h2-9H,10H2,1H3,(H,22,23,27) |
| InChIKey | UIOVZLGUOBZBGJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 133.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|