C18H14ClN3O3S — CID 43836533
4-chloro-N-[4-methyl-5-[(3-nitrophenyl)methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 43836533) has the molecular formula C18H14ClN3O3S and a molecular weight of 387.85 g/mol. Its IUPAC name is 4-chloro-N-[4-methyl-5-[(3-nitrophenyl)methyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[4-methyl-5-[(3-nitrophenyl)methyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 43836533 |
| Molecular Formula | C18H14ClN3O3S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 4-chloro-N-[4-methyl-5-[(3-nitrophenyl)methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | Cc1nc(NC(=O)c2ccc(Cl)cc2)sc1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14ClN3O3S/c1-11-16(10-12-3-2-4-15(9-12)22(24)25)26-18(20-11)21-17(23)13-5-7-14(19)8-6-13/h2-9H,10H2,1H3,(H,20,21,23) |
| InChIKey | QYRQCEDNIAQYQP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|