C21H19ClN4O5S — CID 71617410
N-[4-tert-butyl-5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-3,5-dinitrobenzamide (PubChem CID 71617410) has the molecular formula C21H19ClN4O5S and a molecular weight of 474.93 g/mol. Its IUPAC name is N-[4-tert-butyl-5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[4-tert-butyl-5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 71617410 |
| Molecular Formula | C21H19ClN4O5S |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | N-[4-tert-butyl-5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-3,5-dinitrobenzamide |
| SMILES | CC(C)(C)c1nc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)sc1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClN4O5S/c1-21(2,3)18-17(8-12-4-6-14(22)7-5-12)32-20(23-18)24-19(27)13-9-15(25(28)29)11-16(10-13)26(30)31/h4-7,9-11H,8H2,1-3H3,(H,23,24,27) |
| InChIKey | SDSUXNDTPGXTQK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|