C22H20ClN5O7S — CID 71626014
N-[4-tert-butyl-5-[1-(4-chlorophenyl)-2-nitroethyl]-1,3-thiazol-2-yl]-3,5-dinitrobenzamide (PubChem CID 71626014) has the molecular formula C22H20ClN5O7S and a molecular weight of 533.95 g/mol. Its IUPAC name is N-[4-tert-butyl-5-[1-(4-chlorophenyl)-2-nitroethyl]-1,3-thiazol-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[4-tert-butyl-5-[1-(4-chlorophenyl)-2-nitroethyl]-1,3-thiazol-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 71626014 |
| Molecular Formula | C22H20ClN5O7S |
| Molecular Weight | 533.95 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | N-[4-tert-butyl-5-[1-(4-chlorophenyl)-2-nitroethyl]-1,3-thiazol-2-yl]-3,5-dinitrobenzamide |
| SMILES | CC(C)(C)c1nc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)sc1C(C[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClN5O7S/c1-22(2,3)19-18(17(11-26(30)31)12-4-6-14(23)7-5-12)36-21(24-19)25-20(29)13-8-15(27(32)33)10-16(9-13)28(34)35/h4-10,17H,11H2,1-3H3,(H,24,25,29) |
| InChIKey | LUHYWVGUBIVJIZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 171.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.95 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|