C17H21BrClN3O3S — CID 71627013
N-[4-tert-butyl-5-[1-(4-chlorophenyl)-2-nitroethyl]-1,3-thiazol-2-yl]acetamide;hydrobromide (PubChem CID 71627013) has the molecular formula C17H21BrClN3O3S and a molecular weight of 462.80 g/mol. Its IUPAC name is N-[4-tert-butyl-5-[1-(4-chlorophenyl)-2-nitroethyl]-1,3-thiazol-2-yl]acetamide;hydrobromide.
| Compound Name | N-[4-tert-butyl-5-[1-(4-chlorophenyl)-2-nitroethyl]-1,3-thiazol-2-yl]acetamide;hydrobromide |
|---|---|
| PubChem CID | 71627013 |
| Molecular Formula | C17H21BrClN3O3S |
| Molecular Weight | 462.80 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | N-[4-tert-butyl-5-[1-(4-chlorophenyl)-2-nitroethyl]-1,3-thiazol-2-yl]acetamide;hydrobromide |
| SMILES | Br.CC(=O)Nc1nc(C(C)(C)C)c(C(C[N+](=O)[O-])c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C17H20ClN3O3S.BrH/c1-10(22)19-16-20-15(17(2,3)4)14(25-16)13(9-21(23)24)11-5-7-12(18)8-6-11;/h5-8,13H,9H2,1-4H3,(H,19,20,22);1H |
| InChIKey | YAXFBPKHTZEJBN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.80 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|