C16H14Cl2N2O4 — CID 135062233
1-chloro-4-[(2S,3S)-3-(4-chlorophenyl)-1,4-dinitrobutan-2-yl]benzene (PubChem CID 135062233) has the molecular formula C16H14Cl2N2O4 and a molecular weight of 369.20 g/mol. Its IUPAC name is 1-chloro-4-[(2S,3S)-3-(4-chlorophenyl)-1,4-dinitrobutan-2-yl]benzene.
| Compound Name | 1-chloro-4-[(2S,3S)-3-(4-chlorophenyl)-1,4-dinitrobutan-2-yl]benzene |
|---|---|
| PubChem CID | 135062233 |
| Molecular Formula | C16H14Cl2N2O4 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 1-chloro-4-[(2S,3S)-3-(4-chlorophenyl)-1,4-dinitrobutan-2-yl]benzene |
| SMILES | O=[N+]([O-])C[C@H](c1ccc(Cl)cc1)[C@H](C[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14Cl2N2O4/c17-13-5-1-11(2-6-13)15(9-19(21)22)16(10-20(23)24)12-3-7-14(18)8-4-12/h1-8,15-16H,9-10H2/t15-,16-/m1/s1 |
| InChIKey | QLDHDJAPXFNHCM-HZPDHXFCSA-N |
| XLogP | 4.41 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|