C12H15ClN2O2S — CID 134854320
(3R)-3-(4-chlorophenyl)-N,N-dimethyl-4-nitrobutanethioamide (PubChem CID 134854320) has the molecular formula C12H15ClN2O2S and a molecular weight of 286.78 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-N,N-dimethyl-4-nitrobutanethioamide.
| Compound Name | (3R)-3-(4-chlorophenyl)-N,N-dimethyl-4-nitrobutanethioamide |
|---|---|
| PubChem CID | 134854320 |
| Molecular Formula | C12H15ClN2O2S |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-N,N-dimethyl-4-nitrobutanethioamide |
| SMILES | CN(C)C(=S)C[C@@H](C[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15ClN2O2S/c1-14(2)12(18)7-10(8-15(16)17)9-3-5-11(13)6-4-9/h3-6,10H,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | BJCAVKBCESWDIF-JTQLQIEISA-N |
| XLogP | 2.98 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|