C21H21ClCrN2O8 — CID 15975180
carbon monoxide;[(3S)-3-(4-chlorophenyl)-1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-nitrobutylidene]chromium (PubChem CID 15975180) has the molecular formula C21H21ClCrN2O8 and a molecular weight of 516.85 g/mol. Its IUPAC name is carbon monoxide;[(3S)-3-(4-chlorophenyl)-1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-nitrobutylidene]chromium.
| Compound Name | carbon monoxide;[(3S)-3-(4-chlorophenyl)-1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-nitrobutylidene]chromium |
|---|---|
| PubChem CID | 15975180 |
| Molecular Formula | C21H21ClCrN2O8 |
| Molecular Weight | 516.85 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | carbon monoxide;[(3S)-3-(4-chlorophenyl)-1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-nitrobutylidene]chromium |
| SMILES | C[C@H]1CN(C(=[Cr])C[C@H](C[N+](=O)[O-])c2ccc(Cl)cc2)C[C@H](C)O1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C16H21ClN2O3.5CO.Cr/c1-12-9-18(10-13(2)22-12)8-7-15(11-19(20)21)14-3-5-16(17)6-4-14;5*1-2;/h3-6,12-13,15H,7,9-11H2,1-2H3;;;;;;/t12-,13-,15+;;;;;;/m0....../s1 |
| InChIKey | ONIWBGHXRPWICD-FBJSELLUSA-N |
| XLogP | 2.69 |
| TPSA | 155.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.85 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|