C12H15Cl2N3O4S2 — CID 173445791
carbamothioic S-acid;O-[1-(2,4-dichlorophenyl)-2-nitroethyl] N,N-dimethylcarbamothioate (PubChem CID 173445791) has the molecular formula C12H15Cl2N3O4S2 and a molecular weight of 400.31 g/mol. Its IUPAC name is carbamothioic S-acid;O-[1-(2,4-dichlorophenyl)-2-nitroethyl] N,N-dimethylcarbamothioate.
| Compound Name | carbamothioic S-acid;O-[1-(2,4-dichlorophenyl)-2-nitroethyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 173445791 |
| Molecular Formula | C12H15Cl2N3O4S2 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | carbamothioic S-acid;O-[1-(2,4-dichlorophenyl)-2-nitroethyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)OC(C[N+](=O)[O-])c1ccc(Cl)cc1Cl.NC(=O)S |
| InChI | InChI=1S/C11H12Cl2N2O3S.CH3NOS/c1-14(2)11(19)18-10(6-15(16)17)8-4-3-7(12)5-9(8)13;2-1(3)4/h3-5,10H,6H2,1-2H3;(H3,2,3,4) |
| InChIKey | XNSJHPJOUDGCFA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|