C14H19Cl2NO4 — CID 175407200
[(3S)-1-(2,4-dichlorophenyl)-4-(methoxymethoxy)-3-methylbutyl] carbamate (PubChem CID 175407200) has the molecular formula C14H19Cl2NO4 and a molecular weight of 336.22 g/mol. Its IUPAC name is [(3S)-1-(2,4-dichlorophenyl)-4-(methoxymethoxy)-3-methylbutyl] carbamate.
| Compound Name | [(3S)-1-(2,4-dichlorophenyl)-4-(methoxymethoxy)-3-methylbutyl] carbamate |
|---|---|
| PubChem CID | 175407200 |
| Molecular Formula | C14H19Cl2NO4 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | [(3S)-1-(2,4-dichlorophenyl)-4-(methoxymethoxy)-3-methylbutyl] carbamate |
| SMILES | COCOC[C@@H](C)CC(OC(N)=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2NO4/c1-9(7-20-8-19-2)5-13(21-14(17)18)11-4-3-10(15)6-12(11)16/h3-4,6,9,13H,5,7-8H2,1-2H3,(H2,17,18)/t9-,13?/m0/s1 |
| InChIKey | VENZFLVUXWDEST-LLTODGECSA-N |
| XLogP | 3.78 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|