C13H17Cl2NO3 — CID 56596318
[1-(2,4-dichlorophenyl)-2-hydroxyhexyl] carbamate (PubChem CID 56596318) has the molecular formula C13H17Cl2NO3 and a molecular weight of 306.19 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-2-hydroxyhexyl] carbamate.
| Compound Name | [1-(2,4-dichlorophenyl)-2-hydroxyhexyl] carbamate |
|---|---|
| PubChem CID | 56596318 |
| Molecular Formula | C13H17Cl2NO3 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-2-hydroxyhexyl] carbamate |
| SMILES | CCCCC(O)C(OC(N)=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NO3/c1-2-3-4-11(17)12(19-13(16)18)9-6-5-8(14)7-10(9)15/h5-7,11-12,17H,2-4H2,1H3,(H2,16,18) |
| InChIKey | BELSUWRAEXATJS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |