C12H16Cl2NO5P — CID 2317807
[(R)-(2,4-dichlorophenyl)-diethoxyphosphorylmethyl] carbamate (PubChem CID 2317807) has the molecular formula C12H16Cl2NO5P and a molecular weight of 356.14 g/mol. Its IUPAC name is [(R)-(2,4-dichlorophenyl)-diethoxyphosphorylmethyl] carbamate.
| Compound Name | [(R)-(2,4-dichlorophenyl)-diethoxyphosphorylmethyl] carbamate |
|---|---|
| PubChem CID | 2317807 |
| Molecular Formula | C12H16Cl2NO5P |
| Molecular Weight | 356.14 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | [(R)-(2,4-dichlorophenyl)-diethoxyphosphorylmethyl] carbamate |
| SMILES | CCOP(=O)(OCC)[C@@H](OC(N)=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2NO5P/c1-3-18-21(17,19-4-2)11(20-12(15)16)9-6-5-8(13)7-10(9)14/h5-7,11H,3-4H2,1-2H3,(H2,15,16)/t11-/m1/s1 |
| InChIKey | XIQOFHHQVJMLKL-LLVKDONJSA-N |
| XLogP | 4.35 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.14 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|