C12H18NO6P — CID 4986218
[diethoxyphosphoryl-(2-hydroxyphenyl)methyl] carbamate (PubChem CID 4986218) has the molecular formula C12H18NO6P and a molecular weight of 303.25 g/mol. Its IUPAC name is [diethoxyphosphoryl-(2-hydroxyphenyl)methyl] carbamate.
| Compound Name | [diethoxyphosphoryl-(2-hydroxyphenyl)methyl] carbamate |
|---|---|
| PubChem CID | 4986218 |
| Molecular Formula | C12H18NO6P |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | [diethoxyphosphoryl-(2-hydroxyphenyl)methyl] carbamate |
| SMILES | CCOP(=O)(OCC)C(OC(N)=O)c1ccccc1O |
| InChI | InChI=1S/C12H18NO6P/c1-3-17-20(16,18-4-2)11(19-12(13)15)9-7-5-6-8-10(9)14/h5-8,11,14H,3-4H2,1-2H3,(H2,13,15) |
| InChIKey | ZTQWROGBBJCCHM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|